C29H29F3O4 — CID 89124813
[4-(ethoxymethyl)-2-fluorophenyl] 4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]benzoate (PubChem CID 89124813) has the molecular formula C29H29F3O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is [4-(ethoxymethyl)-2-fluorophenyl] 4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]benzoate.
| Compound Name | [4-(ethoxymethyl)-2-fluorophenyl] 4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 89124813 |
| Molecular Formula | C29H29F3O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [4-(ethoxymethyl)-2-fluorophenyl] 4-[2,3-difluoro-4-(4-methoxycyclohexyl)phenyl]benzoate |
| SMILES | CCOCc1ccc(OC(=O)c2ccc(-c3ccc(C4CCC(OC)CC4)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C29H29F3O4/c1-3-35-17-18-4-15-26(25(30)16-18)36-29(33)21-7-5-19(6-8-21)23-13-14-24(28(32)27(23)31)20-9-11-22(34-2)12-10-20/h4-8,13-16,20,22H,3,9-12,17H2,1-2H3 |
| InChIKey | QAMIIWPWIKMPTG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|