C28H29F3O2 — CID 143908669
[4-[2,3-difluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-(4-ethyl-2-fluorophenoxy)methanol (PubChem CID 143908669) has the molecular formula C28H29F3O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-(4-ethyl-2-fluorophenoxy)methanol.
| Compound Name | [4-[2,3-difluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-(4-ethyl-2-fluorophenoxy)methanol |
|---|---|
| PubChem CID | 143908669 |
| Molecular Formula | C28H29F3O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-methylcyclohexyl)phenyl]phenyl]-(4-ethyl-2-fluorophenoxy)methanol |
| SMILES | CCc1ccc(OC(O)c2ccc(-c3ccc(C4CCC(C)CC4)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C28H29F3O2/c1-3-18-6-15-25(24(29)16-18)33-28(32)21-11-9-20(10-12-21)23-14-13-22(26(30)27(23)31)19-7-4-17(2)5-8-19/h6,9-17,19,28,32H,3-5,7-8H2,1-2H3 |
| InChIKey | WVDIWRRXVJNAMJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|