C26H29F3O — CID 58140593
2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethynyl]cyclohexyl]-4-pentoxybenzene (PubChem CID 58140593) has the molecular formula C26H29F3O and a molecular weight of 414.51 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethynyl]cyclohexyl]-4-pentoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethynyl]cyclohexyl]-4-pentoxybenzene |
|---|---|
| PubChem CID | 58140593 |
| Molecular Formula | C26H29F3O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethynyl]cyclohexyl]-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(C2CCC(C#Cc3ccc(C)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C26H29F3O/c1-3-4-5-16-30-24-15-14-22(25(28)26(24)29)21-12-10-19(11-13-21)8-9-20-7-6-18(2)23(27)17-20/h6-7,14-15,17,19,21H,3-5,10-13,16H2,1-2H3 |
| InChIKey | KEPPTWNVXJZOFC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|