C26H29F3O2 — CID 70961310
1-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]ethynyl]-2-fluorophenyl]butan-1-ol (PubChem CID 70961310) has the molecular formula C26H29F3O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]ethynyl]-2-fluorophenyl]butan-1-ol.
| Compound Name | 1-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]ethynyl]-2-fluorophenyl]butan-1-ol |
|---|---|
| PubChem CID | 70961310 |
| Molecular Formula | C26H29F3O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]ethynyl]-2-fluorophenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C#CC2CCC(c3ccc(OCC)c(F)c3F)CC2)cc1F |
| InChI | InChI=1S/C26H29F3O2/c1-3-5-23(30)21-13-10-18(16-22(21)27)7-6-17-8-11-19(12-9-17)20-14-15-24(31-4-2)26(29)25(20)28/h10,13-17,19,23,30H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | JRJOBJABUMQMPV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|