C28H26F4O — CID 139856368
6-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856368) has the molecular formula C28H26F4O and a molecular weight of 454.51 g/mol. Its IUPAC name is 6-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856368 |
| Molecular Formula | C28H26F4O |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-[4-[2-(4-ethylcyclohexyl)ethynyl]phenyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCC1CCC(C#Cc2ccc(-c3ccc4c(F)c(OCC(F)(F)F)ccc4c3)cc2)CC1 |
| InChI | InChI=1S/C28H26F4O/c1-2-19-3-5-20(6-4-19)7-8-21-9-11-22(12-10-21)23-13-15-25-24(17-23)14-16-26(27(25)29)33-18-28(30,31)32/h9-17,19-20H,2-6,18H2,1H3 |
| InChIKey | XBOCGXPKXKYXHU-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|