C30H30F4O — CID 139855353
2-(difluoromethoxy)-1-fluoro-6-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethynyl]phenyl]naphthalene (PubChem CID 139855353) has the molecular formula C30H30F4O and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1-fluoro-6-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethynyl]phenyl]naphthalene.
| Compound Name | 2-(difluoromethoxy)-1-fluoro-6-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethynyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 139855353 |
| Molecular Formula | C30H30F4O |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-(difluoromethoxy)-1-fluoro-6-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethynyl]phenyl]naphthalene |
| SMILES | CCCCCC1CCC(C#Cc2ccc(-c3ccc4c(F)c(OC(F)F)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H30F4O/c1-2-3-4-5-20-6-8-21(9-7-20)10-11-22-12-15-25(27(31)18-22)23-13-16-26-24(19-23)14-17-28(29(26)32)35-30(33)34/h12-21,30H,2-9H2,1H3 |
| InChIKey | SISHOBLVYVWOMN-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|