C28H24F6O — CID 139855768
6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855768) has the molecular formula C28H24F6O and a molecular weight of 490.49 g/mol. Its IUPAC name is 6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855768 |
| Molecular Formula | C28H24F6O |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCC1CCC(C#Cc2ccc(-c3ccc4c(F)c(OCC(F)(F)F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H24F6O/c1-2-17-3-5-18(6-4-17)7-8-19-9-11-22(24(29)13-19)20-10-12-23-21(14-20)15-25(30)27(26(23)31)35-16-28(32,33)34/h9-15,17-18H,2-6,16H2,1H3 |
| InChIKey | FZJFZHJUSNIXFB-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|