C27H23F5O — CID 139856248
2-(difluoromethoxy)-6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoronaphthalene (PubChem CID 139856248) has the molecular formula C27H23F5O and a molecular weight of 458.47 g/mol. Its IUPAC name is 2-(difluoromethoxy)-6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(difluoromethoxy)-6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139856248 |
| Molecular Formula | C27H23F5O |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-(difluoromethoxy)-6-[4-[2-(4-ethylcyclohexyl)ethynyl]-2-fluorophenyl]-1,3-difluoronaphthalene |
| SMILES | CCC1CCC(C#Cc2ccc(-c3ccc4c(F)c(OC(F)F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H23F5O/c1-2-16-3-5-17(6-4-16)7-8-18-9-11-21(23(28)13-18)19-10-12-22-20(14-19)15-24(29)26(25(22)30)33-27(31)32/h9-17,27H,2-6H2,1H3 |
| InChIKey | SFJLILRMDSLZHG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|