C26H20F6 — CID 139854076
6-[2-[4-(4-ethylcyclohexyl)-2,3,5-trifluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139854076) has the molecular formula C26H20F6 and a molecular weight of 446.43 g/mol. Its IUPAC name is 6-[2-[4-(4-ethylcyclohexyl)-2,3,5-trifluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-(4-ethylcyclohexyl)-2,3,5-trifluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139854076 |
| Molecular Formula | C26H20F6 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 6-[2-[4-(4-ethylcyclohexyl)-2,3,5-trifluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCC1CCC(c2c(F)cc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C26H20F6/c1-2-14-3-7-16(8-4-14)22-20(27)12-17(23(29)26(22)32)9-5-15-6-10-19-18(11-15)13-21(28)25(31)24(19)30/h6,10-14,16H,2-4,7-8H2,1H3 |
| InChIKey | XGTAMWZGKYDGBL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|