C22H13F5O — CID 139854318
6-[2-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139854318) has the molecular formula C22H13F5O and a molecular weight of 388.34 g/mol. Its IUPAC name is 6-[2-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139854318 |
| Molecular Formula | C22H13F5O |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 6-[2-[4-[(E)-but-2-enoxy]-2,3-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | C/C=C/COc1ccc(C#Cc2ccc3c(F)c(F)c(F)cc3c2)c(F)c1F |
| InChI | InChI=1S/C22H13F5O/c1-2-3-10-28-18-9-7-14(19(24)22(18)27)6-4-13-5-8-16-15(11-13)12-17(23)21(26)20(16)25/h2-3,5,7-9,11-12H,10H2,1H3/b3-2+ |
| InChIKey | BCZPWMNUBCIDCD-NSCUHMNNSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|