C30H20F6O — CID 139857682
6-[2-[4-[1-[2-[(E)-but-2-enoxy]phenyl]-2-fluoroethyl]-2,6-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139857682) has the molecular formula C30H20F6O and a molecular weight of 510.48 g/mol. Its IUPAC name is 6-[2-[4-[1-[2-[(E)-but-2-enoxy]phenyl]-2-fluoroethyl]-2,6-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[1-[2-[(E)-but-2-enoxy]phenyl]-2-fluoroethyl]-2,6-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139857682 |
| Molecular Formula | C30H20F6O |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 6-[2-[4-[1-[2-[(E)-but-2-enoxy]phenyl]-2-fluoroethyl]-2,6-difluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | C/C=C/COc1ccccc1C(CF)c1cc(F)c(C#Cc2ccc3c(F)c(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C30H20F6O/c1-2-3-12-37-28-7-5-4-6-22(28)24(17-31)20-14-25(32)23(26(33)15-20)11-9-18-8-10-21-19(13-18)16-27(34)30(36)29(21)35/h2-8,10,13-16,24H,12,17H2,1H3/b3-2+ |
| InChIKey | GBMWARORONBSBT-NSCUHMNNSA-N |
| XLogP | 7.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|