C19H10F4O — CID 139854060
6-[2-(2,3-difluoro-4-methoxyphenyl)ethynyl]-2,3-difluoronaphthalene (PubChem CID 139854060) has the molecular formula C19H10F4O and a molecular weight of 330.28 g/mol. Its IUPAC name is 6-[2-(2,3-difluoro-4-methoxyphenyl)ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-(2,3-difluoro-4-methoxyphenyl)ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139854060 |
| Molecular Formula | C19H10F4O |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 6-[2-(2,3-difluoro-4-methoxyphenyl)ethynyl]-2,3-difluoronaphthalene |
| SMILES | COc1ccc(C#Cc2ccc3cc(F)c(F)cc3c2)c(F)c1F |
| InChI | InChI=1S/C19H10F4O/c1-24-17-7-6-12(18(22)19(17)23)4-2-11-3-5-13-9-15(20)16(21)10-14(13)8-11/h3,5-10H,1H3 |
| InChIKey | FDVOZIHUYKBRET-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|