C22H15F3O — CID 70820083
2,3-difluoro-1-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-4-methoxybenzene (PubChem CID 70820083) has the molecular formula C22H15F3O and a molecular weight of 352.36 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-4-methoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 70820083 |
| Molecular Formula | C22H15F3O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-4-methoxybenzene |
| SMILES | COc1ccc(-c2ccc(C#Cc3ccc(C)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C22H15F3O/c1-14-3-7-17(19(23)13-14)10-6-15-4-8-16(9-5-15)18-11-12-20(26-2)22(25)21(18)24/h3-5,7-9,11-13H,1-2H3 |
| InChIKey | UMMVJNAOSCXQTC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|