C25H14F4 — CID 139846851
1,2-difluoro-6-[2-fluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]naphthalene (PubChem CID 139846851) has the molecular formula C25H14F4 and a molecular weight of 390.38 g/mol. Its IUPAC name is 1,2-difluoro-6-[2-fluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]naphthalene.
| Compound Name | 1,2-difluoro-6-[2-fluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 139846851 |
| Molecular Formula | C25H14F4 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1,2-difluoro-6-[2-fluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]naphthalene |
| SMILES | Cc1ccc(C#Cc2ccc(-c3ccc4c(F)c(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H14F4/c1-15-2-5-17(23(27)12-15)6-3-16-4-9-20(24(28)13-16)18-7-10-21-19(14-18)8-11-22(26)25(21)29/h2,4-5,7-14H,1H3 |
| InChIKey | QFYVEFLDBDUYMO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|