C17H12F2 — CID 70883391
1,2-difluoro-6-(4-methylphenyl)naphthalene (PubChem CID 70883391) has the molecular formula C17H12F2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1,2-difluoro-6-(4-methylphenyl)naphthalene.
| Compound Name | 1,2-difluoro-6-(4-methylphenyl)naphthalene |
|---|---|
| PubChem CID | 70883391 |
| Molecular Formula | C17H12F2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1,2-difluoro-6-(4-methylphenyl)naphthalene |
| SMILES | Cc1ccc(-c2ccc3c(F)c(F)ccc3c2)cc1 |
| InChI | InChI=1S/C17H12F2/c1-11-2-4-12(5-3-11)13-6-8-15-14(10-13)7-9-16(18)17(15)19/h2-10H,1H3 |
| InChIKey | VTLIVEMTBCVRFV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |