C17H9F5 — CID 151175004
6-[4-(difluoromethyl)phenyl]-1,2,3-trifluoronaphthalene (PubChem CID 151175004) has the molecular formula C17H9F5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 6-[4-(difluoromethyl)phenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-(difluoromethyl)phenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 151175004 |
| Molecular Formula | C17H9F5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-[4-(difluoromethyl)phenyl]-1,2,3-trifluoronaphthalene |
| SMILES | Fc1cc2cc(-c3ccc(C(F)F)cc3)ccc2c(F)c1F |
| InChI | InChI=1S/C17H9F5/c18-14-8-12-7-11(5-6-13(12)15(19)16(14)20)9-1-3-10(4-2-9)17(21)22/h1-8,17H |
| InChIKey | NDBVZIWLIGNYJI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|