C24H13F5 — CID 139847194
6-[4-(4-ethenyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene (PubChem CID 139847194) has the molecular formula C24H13F5 and a molecular weight of 396.36 g/mol. Its IUPAC name is 6-[4-(4-ethenyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-(4-ethenyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139847194 |
| Molecular Formula | C24H13F5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 6-[4-(4-ethenyl-2-fluorophenyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene |
| SMILES | C=Cc1ccc(-c2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C24H13F5/c1-2-13-3-6-17(20(25)9-13)15-4-7-18(21(26)11-15)14-5-8-19-16(10-14)12-22(27)24(29)23(19)28/h2-12H,1H2 |
| InChIKey | SDYUCUDYWBSWCU-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|