C18H9F5 — CID 139846798
6-(4-ethenyl-2,6-difluorophenyl)-1,2,3-trifluoronaphthalene (PubChem CID 139846798) has the molecular formula C18H9F5 and a molecular weight of 320.26 g/mol. Its IUPAC name is 6-(4-ethenyl-2,6-difluorophenyl)-1,2,3-trifluoronaphthalene.
| Compound Name | 6-(4-ethenyl-2,6-difluorophenyl)-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139846798 |
| Molecular Formula | C18H9F5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 6-(4-ethenyl-2,6-difluorophenyl)-1,2,3-trifluoronaphthalene |
| SMILES | C=Cc1cc(F)c(-c2ccc3c(F)c(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C18H9F5/c1-2-9-5-13(19)16(14(20)6-9)10-3-4-12-11(7-10)8-15(21)18(23)17(12)22/h2-8H,1H2 |
| InChIKey | FWGYRQZFJJYWKH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|