C27H20F6O — CID 90786833
1,3-difluoro-2-methyl-6-(2,4,6-trifluorophenyl)naphthalene;2,4,6-trimethylbenzoyl fluoride (PubChem CID 90786833) has the molecular formula C27H20F6O and a molecular weight of 474.44 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-6-(2,4,6-trifluorophenyl)naphthalene;2,4,6-trimethylbenzoyl fluoride.
| Compound Name | 1,3-difluoro-2-methyl-6-(2,4,6-trifluorophenyl)naphthalene;2,4,6-trimethylbenzoyl fluoride |
|---|---|
| PubChem CID | 90786833 |
| Molecular Formula | C27H20F6O |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1,3-difluoro-2-methyl-6-(2,4,6-trifluorophenyl)naphthalene;2,4,6-trimethylbenzoyl fluoride |
| SMILES | Cc1c(F)cc2cc(-c3c(F)cc(F)cc3F)ccc2c1F.Cc1cc(C)c(C(=O)F)c(C)c1 |
| InChI | InChI=1S/C17H9F5.C10H11FO/c1-8-13(19)5-10-4-9(2-3-12(10)17(8)22)16-14(20)6-11(18)7-15(16)21;1-6-4-7(2)9(10(11)12)8(3)5-6/h2-7H,1H3;4-5H,1-3H3 |
| InChIKey | RWMVUEPAUBOQLH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|