C17H9F3O — CID 118001113
4-(5,6,7-trifluoronaphthalen-2-yl)benzaldehyde (PubChem CID 118001113) has the molecular formula C17H9F3O and a molecular weight of 286.25 g/mol. Its IUPAC name is 4-(5,6,7-trifluoronaphthalen-2-yl)benzaldehyde.
| Compound Name | 4-(5,6,7-trifluoronaphthalen-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 118001113 |
| Molecular Formula | C17H9F3O |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-(5,6,7-trifluoronaphthalen-2-yl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c(F)c(F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C17H9F3O/c18-15-8-13-7-12(5-6-14(13)16(19)17(15)20)11-3-1-10(9-21)2-4-11/h1-9H |
| InChIKey | WHODZCXOMCAUPS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|