C48H28O4 — CID 170691767
4-[4,9,10-tris(4-formylphenyl)perylen-3-yl]benzaldehyde (PubChem CID 170691767) has the molecular formula C48H28O4 and a molecular weight of 668.75 g/mol. Its IUPAC name is 4-[4,9,10-tris(4-formylphenyl)perylen-3-yl]benzaldehyde.
| Compound Name | 4-[4,9,10-tris(4-formylphenyl)perylen-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 170691767 |
| Molecular Formula | C48H28O4 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | 4-[4,9,10-tris(4-formylphenyl)perylen-3-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c4ccc(-c5ccc(C=O)cc5)c5c(-c6ccc(C=O)cc6)ccc(c6ccc(-c7ccc(C=O)cc7)c2c36)c54)cc1 |
| InChI | InChI=1S/C48H28O4/c49-25-29-1-9-33(10-2-29)37-17-21-41-43-23-19-39(35-13-5-31(27-51)6-14-35)46-40(36-15-7-32(28-52)8-16-36)20-24-44(48(43)46)42-22-18-38(45(37)47(41)42)34-11-3-30(26-50)4-12-34/h1-28H |
| InChIKey | XVOGQGZDZCGALJ-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|