About 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde
4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde (PubChem CID 175725240) has the molecular formula C44H26O4
and a molecular weight of 619.69 g/mol. Its IUPAC name is 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde |
| PubChem CID | 175725240 |
| Molecular Formula | C44H26O4 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde |
| SMILES | [2H]c1c(-c2ccc(C=O)cc2)c2ccc3c(-c4ccc(C=O)cc4)cc(-c4ccc(C=O)cc4)c4ccc(c1-c1ccc(C=O)cc1)c2c34 |
| InChI | InChI=1S/C44H26O4/c45-23-27-1-9-31(10-2-27)39-21-40(32-11-3-28(24-46)4-12-32)36-19-20-38-42(34-15-7-30(26-48)8-16-34)22-41(33-13-5-29(25-47)6-14-33)37-18-17-35(39)43(36)44(37)38/h1-26H/i21D |
| InChIKey | ZGLHKEJAGHMUHR-KRLANHAZSA-N |
| XLogP | 10.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde?
The IUPAC name of 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde (CID 175725240) is 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde.
What is the SMILES notation for 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde?
The canonical SMILES for 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde is [2H]c1c(-c2ccc(C=O)cc2)c2ccc3c(-c4ccc(C=O)cc4)cc(-c4ccc(C=O)cc4)c4ccc(c1-c1ccc(C=O)cc1)c2c34.
What is the InChIKey of 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde?
The InChIKey is ZGLHKEJAGHMUHR-KRLANHAZSA-N. The full InChI is InChI=1S/C44H26O4/c45-23-27-1-9-31(10-2-27)39-21-40(32-11-3-28(24-46)4-12-32)36-19-20-38-42(34-15-7-30(26-48)8-16-34)22-41(33-13-5-29(25-47)6-14-33)37-18-17-35(39)43(36)44(37)38/h1-26H/i21D.
What are the key properties of 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde?
4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde has a molecular weight of 619.69 g/mol, XLogP of 10.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde is sourced from PubChem (CID 175725240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).