C44H26O4 — CID 175725240
4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde (PubChem CID 175725240) has the molecular formula C44H26O4 and a molecular weight of 619.69 g/mol. Its IUPAC name is 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde.
| Compound Name | 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 175725240 |
| Molecular Formula | C44H26O4 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 4-[7-deuterio-3,6,8-tris(4-formylphenyl)pyren-1-yl]benzaldehyde |
| SMILES | [2H]c1c(-c2ccc(C=O)cc2)c2ccc3c(-c4ccc(C=O)cc4)cc(-c4ccc(C=O)cc4)c4ccc(c1-c1ccc(C=O)cc1)c2c34 |
| InChI | InChI=1S/C44H26O4/c45-23-27-1-9-31(10-2-27)39-21-40(32-11-3-28(24-46)4-12-32)36-19-20-38-42(34-15-7-30(26-48)8-16-34)22-41(33-13-5-29(25-47)6-14-33)37-18-17-35(39)43(36)44(37)38/h1-26H/i21D |
| InChIKey | ZGLHKEJAGHMUHR-KRLANHAZSA-N |
| XLogP | 10.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|