C36H21NO3 — CID 54770634
4-[4-[(15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-16-yl)methyl]phenyl]benzaldehyde (PubChem CID 54770634) has the molecular formula C36H21NO3 and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-[4-[(15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-16-yl)methyl]phenyl]benzaldehyde.
| Compound Name | 4-[4-[(15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-16-yl)methyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 54770634 |
| Molecular Formula | C36H21NO3 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 4-[4-[(15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-16-yl)methyl]phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(CN3C(=O)c4ccc5c6cccc7cccc(c8ccc(c4c58)C3=O)c76)cc2)cc1 |
| InChI | InChI=1S/C36H21NO3/c38-20-22-9-13-24(14-10-22)23-11-7-21(8-12-23)19-37-35(39)30-17-15-28-26-5-1-3-25-4-2-6-27(32(25)26)29-16-18-31(36(37)40)34(30)33(28)29/h1-18,20H,19H2 |
| InChIKey | JCLRMORIGBCOAB-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|