C14H9F6N — CID 107643770
N-[[4-(difluoromethyl)phenyl]methyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643770) has the molecular formula C14H9F6N and a molecular weight of 305.22 g/mol. Its IUPAC name is N-[[4-(difluoromethyl)phenyl]methyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[[4-(difluoromethyl)phenyl]methyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643770 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[[4-(difluoromethyl)phenyl]methyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | Fc1cc(F)c(F)c(NCc2ccc(C(F)F)cc2)c1F |
| InChI | InChI=1S/C14H9F6N/c15-9-5-10(16)12(18)13(11(9)17)21-6-7-1-3-8(4-2-7)14(19)20/h1-5,14,21H,6H2 |
| InChIKey | WKMCXGWMEPMKPN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|