C13H8F4IN — CID 107644269
2,3,5,6-tetrafluoro-N-[(4-iodophenyl)methyl]aniline (PubChem CID 107644269) has the molecular formula C13H8F4IN and a molecular weight of 381.11 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(4-iodophenyl)methyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(4-iodophenyl)methyl]aniline |
|---|---|
| PubChem CID | 107644269 |
| Molecular Formula | C13H8F4IN |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(4-iodophenyl)methyl]aniline |
| SMILES | Fc1cc(F)c(F)c(NCc2ccc(I)cc2)c1F |
| InChI | InChI=1S/C13H8F4IN/c14-9-5-10(15)12(17)13(11(9)16)19-6-7-1-3-8(18)4-2-7/h1-5,19H,6H2 |
| InChIKey | FUBLHZBCABJLHE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|