C19H9F5O — CID 139854630
2,3-difluoro-6-[2-(2,3,5-trifluoro-4-methoxyphenyl)ethynyl]naphthalene (PubChem CID 139854630) has the molecular formula C19H9F5O and a molecular weight of 348.27 g/mol. Its IUPAC name is 2,3-difluoro-6-[2-(2,3,5-trifluoro-4-methoxyphenyl)ethynyl]naphthalene.
| Compound Name | 2,3-difluoro-6-[2-(2,3,5-trifluoro-4-methoxyphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139854630 |
| Molecular Formula | C19H9F5O |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2,3-difluoro-6-[2-(2,3,5-trifluoro-4-methoxyphenyl)ethynyl]naphthalene |
| SMILES | COc1c(F)cc(C#Cc2ccc3cc(F)c(F)cc3c2)c(F)c1F |
| InChI | InChI=1S/C19H9F5O/c1-25-19-16(22)8-12(17(23)18(19)24)5-3-10-2-4-11-7-14(20)15(21)9-13(11)6-10/h2,4,6-9H,1H3 |
| InChIKey | XUKASBLIMOUJCE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|