C22H12F6 — CID 139854188
6-[2-(4-but-3-enyl-2,3,5-trifluorophenyl)ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139854188) has the molecular formula C22H12F6 and a molecular weight of 390.33 g/mol. Its IUPAC name is 6-[2-(4-but-3-enyl-2,3,5-trifluorophenyl)ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-(4-but-3-enyl-2,3,5-trifluorophenyl)ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139854188 |
| Molecular Formula | C22H12F6 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 6-[2-(4-but-3-enyl-2,3,5-trifluorophenyl)ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | C=CCCc1c(F)cc(C#Cc2ccc3c(F)c(F)c(F)cc3c2)c(F)c1F |
| InChI | InChI=1S/C22H12F6/c1-2-3-4-16-17(23)10-13(19(25)21(16)27)7-5-12-6-8-15-14(9-12)11-18(24)22(28)20(15)26/h2,6,8-11H,1,3-4H2 |
| InChIKey | GFDKAXYZPPWSTB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|