C26H20F4O2 — CID 139858581
(2R,5S)-2-but-3-enyl-5-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane (PubChem CID 139858581) has the molecular formula C26H20F4O2 and a molecular weight of 440.44 g/mol. Its IUPAC name is (2R,5S)-2-but-3-enyl-5-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane.
| Compound Name | (2R,5S)-2-but-3-enyl-5-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 139858581 |
| Molecular Formula | C26H20F4O2 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2R,5S)-2-but-3-enyl-5-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane |
| SMILES | C=CCC[C@@H]1CO[C@@H](c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CO1 |
| InChI | InChI=1S/C26H20F4O2/c1-2-3-4-20-14-32-24(15-31-20)18-9-8-17(22(27)12-18)7-5-16-6-10-21-19(11-16)13-23(28)26(30)25(21)29/h2,6,8-13,20,24H,1,3-4,14-15H2/t20-,24-/m1/s1 |
| InChIKey | AUAZYUSVUSICOL-HYBUGGRVSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|