C25H19F3O2 — CID 139856701
2-prop-2-enyl-5-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane (PubChem CID 139856701) has the molecular formula C25H19F3O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-prop-2-enyl-5-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane.
| Compound Name | 2-prop-2-enyl-5-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 139856701 |
| Molecular Formula | C25H19F3O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-prop-2-enyl-5-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-1,4-dioxane |
| SMILES | C=CCC1COC(c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)CO1 |
| InChI | InChI=1S/C25H19F3O2/c1-2-3-20-14-30-23(15-29-20)18-9-6-16(7-10-18)4-5-17-8-11-21-19(12-17)13-22(26)25(28)24(21)27/h2,6-13,20,23H,1,3,14-15H2 |
| InChIKey | AYLBZUXRMRFGAY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|