C27H25F3O3 — CID 139856962
5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane (PubChem CID 139856962) has the molecular formula C27H25F3O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane.
| Compound Name | 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139856962 |
| Molecular Formula | C27H25F3O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane |
| SMILES | COCCC1COC(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)OC1 |
| InChI | InChI=1S/C27H25F3O3/c1-31-13-12-21-16-32-25(33-17-21)11-9-19-4-2-18(3-5-19)6-7-20-8-10-23-22(14-20)15-24(28)27(30)26(23)29/h2-5,8,10,14-15,21,25H,9,11-13,16-17H2,1H3 |
| InChIKey | JLNOONMNHBHKFC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|