C28H22F3NO — CID 139857673
5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine (PubChem CID 139857673) has the molecular formula C28H22F3NO and a molecular weight of 445.48 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine.
| Compound Name | 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 139857673 |
| Molecular Formula | C28H22F3NO |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5-(2-methoxyethyl)-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]pyridine |
| SMILES | COCCc1ccc(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)nc1 |
| InChI | InChI=1S/C28H22F3NO/c1-33-15-14-22-9-12-24(32-18-22)11-8-20-4-2-19(3-5-20)6-7-21-10-13-25-23(16-21)17-26(29)28(31)27(25)30/h2-5,9-10,12-13,16-18H,8,11,14-15H2,1H3 |
| InChIKey | FWLCTYMXFNYOAX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|