C26H19F2NO — CID 139857708
2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine (PubChem CID 139857708) has the molecular formula C26H19F2NO and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine.
| Compound Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine |
|---|---|
| PubChem CID | 139857708 |
| Molecular Formula | C26H19F2NO |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine |
| SMILES | COCCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)cc2)nc1 |
| InChI | InChI=1S/C26H19F2NO/c1-30-15-14-20-7-13-25(29-17-20)21-8-4-18(5-9-21)2-3-19-6-11-23-22(16-19)10-12-24(27)26(23)28/h4-13,16-17H,14-15H2,1H3 |
| InChIKey | SUANDFJYUDTFHB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|