C26H19F3N2O — CID 139859560
5-(3-methoxypropyl)-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine (PubChem CID 139859560) has the molecular formula C26H19F3N2O and a molecular weight of 432.45 g/mol. Its IUPAC name is 5-(3-methoxypropyl)-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine.
| Compound Name | 5-(3-methoxypropyl)-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 139859560 |
| Molecular Formula | C26H19F3N2O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-(3-methoxypropyl)-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
| SMILES | COCCCc1cnc(-c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)nc1 |
| InChI | InChI=1S/C26H19F3N2O/c1-32-12-2-3-19-15-30-26(31-16-19)20-9-6-17(7-10-20)4-5-18-8-11-22-21(13-18)14-23(27)25(29)24(22)28/h6-11,13-16H,2-3,12H2,1H3 |
| InChIKey | ICCMMRQSOCTWEV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|