C26H17F3N2 — CID 139858771
5-but-3-enyl-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine (PubChem CID 139858771) has the molecular formula C26H17F3N2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 139858771 |
| Molecular Formula | C26H17F3N2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-but-3-enyl-2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
| SMILES | C=CCCc1cnc(-c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)nc1 |
| InChI | InChI=1S/C26H17F3N2/c1-2-3-4-19-15-30-26(31-16-19)20-10-7-17(8-11-20)5-6-18-9-12-22-21(13-18)14-23(27)25(29)24(22)28/h2,7-16H,1,3-4H2 |
| InChIKey | IYGJLLPDSOIXAT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|