C26H17F4NO — CID 139857991
2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine (PubChem CID 139857991) has the molecular formula C26H17F4NO and a molecular weight of 435.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine.
| Compound Name | 2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine |
|---|---|
| PubChem CID | 139857991 |
| Molecular Formula | C26H17F4NO |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(2-methoxyethyl)pyridine |
| SMILES | COCCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C26H17F4NO/c1-32-11-10-17-4-9-24(31-15-17)19-7-6-18(22(27)13-19)5-2-16-3-8-21-20(12-16)14-23(28)26(30)25(21)29/h3-4,6-9,12-15H,10-11H2,1H3 |
| InChIKey | SQJBTIHXPQDLQM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|