C25H17F2NO — CID 139859162
2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)pyridine (PubChem CID 139859162) has the molecular formula C25H17F2NO and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)pyridine.
| Compound Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)pyridine |
|---|---|
| PubChem CID | 139859162 |
| Molecular Formula | C25H17F2NO |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)pyridine |
| SMILES | COCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)cc2)nc1 |
| InChI | InChI=1S/C25H17F2NO/c1-29-16-19-7-13-24(28-15-19)20-8-4-17(5-9-20)2-3-18-6-11-22-21(14-18)10-12-23(26)25(22)27/h4-15H,16H2,1H3 |
| InChIKey | HWERHRAXTFNTCI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|