C25H15F4NO — CID 139859351
2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-(methoxymethyl)pyridine (PubChem CID 139859351) has the molecular formula C25H15F4NO and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-(methoxymethyl)pyridine.
| Compound Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-(methoxymethyl)pyridine |
|---|---|
| PubChem CID | 139859351 |
| Molecular Formula | C25H15F4NO |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-(methoxymethyl)pyridine |
| SMILES | COCc1ccc(-c2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C25H15F4NO/c1-31-14-16-4-7-25(30-13-16)19-11-21(26)20(22(27)12-19)6-3-15-2-5-17-9-23(28)24(29)10-18(17)8-15/h2,4-5,7-13H,14H2,1H3 |
| InChIKey | FGGGFSHMIFXSPK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|