C24H32F2O2 — CID 54456824
[4-(4-pent-4-enylcyclohexyl)cyclohexyl] 3,4-difluorobenzoate (PubChem CID 54456824) has the molecular formula C24H32F2O2 and a molecular weight of 390.51 g/mol. Its IUPAC name is [4-(4-pent-4-enylcyclohexyl)cyclohexyl] 3,4-difluorobenzoate.
| Compound Name | [4-(4-pent-4-enylcyclohexyl)cyclohexyl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 54456824 |
| Molecular Formula | C24H32F2O2 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [4-(4-pent-4-enylcyclohexyl)cyclohexyl] 3,4-difluorobenzoate |
| SMILES | C=CCCCC1CCC(C2CCC(OC(=O)c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H32F2O2/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-13-21(14-11-19)28-24(27)20-12-15-22(25)23(26)16-20/h2,12,15-19,21H,1,3-11,13-14H2 |
| InChIKey | WYTWIWNDAXACPX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|