C25H41F3Si2 — CID 173330653
1-pentyl-4-[4-[(3S,6R)-6-(3,4,5-trifluorophenyl)silinan-3-yl]butyl]silinane (PubChem CID 173330653) has the molecular formula C25H41F3Si2 and a molecular weight of 454.77 g/mol. Its IUPAC name is 1-pentyl-4-[4-[(3S,6R)-6-(3,4,5-trifluorophenyl)silinan-3-yl]butyl]silinane.
| Compound Name | 1-pentyl-4-[4-[(3S,6R)-6-(3,4,5-trifluorophenyl)silinan-3-yl]butyl]silinane |
|---|---|
| PubChem CID | 173330653 |
| Molecular Formula | C25H41F3Si2 |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-pentyl-4-[4-[(3S,6R)-6-(3,4,5-trifluorophenyl)silinan-3-yl]butyl]silinane |
| SMILES | CCCCC[SiH]1CCC(CCCC[C@H]2CC[C@H](c3cc(F)c(F)c(F)c3)[SiH2]C2)CC1 |
| InChI | InChI=1S/C25H41F3Si2/c1-2-3-6-13-30-14-11-19(12-15-30)7-4-5-8-20-9-10-24(29-18-20)21-16-22(26)25(28)23(27)17-21/h16-17,19-20,24,30H,2-15,18,29H2,1H3/t19?,20-,24+,30?/m0/s1 |
| InChIKey | XOUAPSMEYMPDCT-WJSBYHIWSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|