C21H29F3 — CID 67680831
1,2,3-trifluoro-5-[4-(4-pentylcyclohexyl)but-1-enyl]benzene (PubChem CID 67680831) has the molecular formula C21H29F3 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-(4-pentylcyclohexyl)but-1-enyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-(4-pentylcyclohexyl)but-1-enyl]benzene |
|---|---|
| PubChem CID | 67680831 |
| Molecular Formula | C21H29F3 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-(4-pentylcyclohexyl)but-1-enyl]benzene |
| SMILES | CCCCCC1CCC(CCC=Cc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H29F3/c1-2-3-4-7-16-10-12-17(13-11-16)8-5-6-9-18-14-19(22)21(24)20(23)15-18/h6,9,14-17H,2-5,7-8,10-13H2,1H3 |
| InChIKey | PGJQIYTVFCWTIQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|