C27H43ClF2Si — CID 70184894
4-[4-[4-[4-chloro-2-(difluoromethyl)phenyl]cyclohexyl]butyl]-1-pentylsilinane (PubChem CID 70184894) has the molecular formula C27H43ClF2Si and a molecular weight of 469.18 g/mol. Its IUPAC name is 4-[4-[4-[4-chloro-2-(difluoromethyl)phenyl]cyclohexyl]butyl]-1-pentylsilinane.
| Compound Name | 4-[4-[4-[4-chloro-2-(difluoromethyl)phenyl]cyclohexyl]butyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 70184894 |
| Molecular Formula | C27H43ClF2Si |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 4-[4-[4-[4-chloro-2-(difluoromethyl)phenyl]cyclohexyl]butyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(CCCCC2CCC(c3ccc(Cl)cc3C(F)F)CC2)CC1 |
| InChI | InChI=1S/C27H43ClF2Si/c1-2-3-6-17-31-18-15-22(16-19-31)8-5-4-7-21-9-11-23(12-10-21)25-14-13-24(28)20-26(25)27(29)30/h13-14,20-23,27,31H,2-12,15-19H2,1H3 |
| InChIKey | LMYCCNDPAMPDSD-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|