C28H28F5NO — CID 130203732
1-[3,5-difluoro-4-[[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]phenyl]propan-1-amine (PubChem CID 130203732) has the molecular formula C28H28F5NO and a molecular weight of 489.53 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]phenyl]propan-1-amine.
| Compound Name | 1-[3,5-difluoro-4-[[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 130203732 |
| Molecular Formula | C28H28F5NO |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[3,5-difluoro-4-[[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]methoxy]phenyl]propan-1-amine |
| SMILES | CCC(N)c1cc(F)c(OCC2CCC(c3ccc(-c4cc(F)c(F)c(F)c4)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H28F5NO/c1-2-26(34)21-13-24(31)28(25(32)14-21)35-15-16-3-5-17(6-4-16)18-7-9-19(10-8-18)20-11-22(29)27(33)23(30)12-20/h7-14,16-17,26H,2-6,15,34H2,1H3 |
| InChIKey | YDYPIYNEQKDMEI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|