C9H11Br2ClF2N2 — CID 171312845
2-[(1S)-1-amino-3,3-difluoropropyl]-4,6-dibromoaniline;hydrochloride (PubChem CID 171312845) has the molecular formula C9H11Br2ClF2N2 and a molecular weight of 380.46 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3,3-difluoropropyl]-4,6-dibromoaniline;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3,3-difluoropropyl]-4,6-dibromoaniline;hydrochloride |
|---|---|
| PubChem CID | 171312845 |
| Molecular Formula | C9H11Br2ClF2N2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 377.89 |
| IUPAC Name | 2-[(1S)-1-amino-3,3-difluoropropyl]-4,6-dibromoaniline;hydrochloride |
| SMILES | Cl.Nc1c(Br)cc(Br)cc1[C@@H](N)CC(F)F |
| InChI | InChI=1S/C9H10Br2F2N2.ClH/c10-4-1-5(7(14)3-8(12)13)9(15)6(11)2-4;/h1-2,7-8H,3,14-15H2;1H/t7-;/m0./s1 |
| InChIKey | MWMOCOCBDJQLOW-FJXQXJEOSA-N |
| XLogP | 3.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|