C9H11Cl2F2NO2 — CID 171241275
2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-chlorophenol;hydrochloride (PubChem CID 171241275) has the molecular formula C9H11Cl2F2NO2 and a molecular weight of 274.09 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-chlorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-chlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171241275 |
| Molecular Formula | C9H11Cl2F2NO2 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-chlorophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(Cl)c1O)C(F)(F)CO |
| InChI | InChI=1S/C9H10ClF2NO2.ClH/c10-6-3-1-2-5(7(6)15)8(13)9(11,12)4-14;/h1-3,8,14-15H,4,13H2;1H/t8-;/m1./s1 |
| InChIKey | IOLPUYQVEIYPKQ-DDWIOCJRSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|