C16H23Cl2NO2 — CID 123585991
2,4-dichloro-6-(1-nitrosodecyl)phenol (PubChem CID 123585991) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2,4-dichloro-6-(1-nitrosodecyl)phenol.
| Compound Name | 2,4-dichloro-6-(1-nitrosodecyl)phenol |
|---|---|
| PubChem CID | 123585991 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2,4-dichloro-6-(1-nitrosodecyl)phenol |
| SMILES | CCCCCCCCCC(N=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H23Cl2NO2/c1-2-3-4-5-6-7-8-9-15(19-21)13-10-12(17)11-14(18)16(13)20/h10-11,15,20H,2-9H2,1H3 |
| InChIKey | RXQAPYRFBPMLFY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|