C16H26Cl2N2O3S — CID 54289316
3,5-dichloro-N-[2-(dimethylamino)ethyl]-N-hexyl-2-hydroxybenzenesulfonamide (PubChem CID 54289316) has the molecular formula C16H26Cl2N2O3S and a molecular weight of 397.37 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(dimethylamino)ethyl]-N-hexyl-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[2-(dimethylamino)ethyl]-N-hexyl-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 54289316 |
| Molecular Formula | C16H26Cl2N2O3S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3,5-dichloro-N-[2-(dimethylamino)ethyl]-N-hexyl-2-hydroxybenzenesulfonamide |
| SMILES | CCCCCCN(CCN(C)C)S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H26Cl2N2O3S/c1-4-5-6-7-8-20(10-9-19(2)3)24(22,23)15-12-13(17)11-14(18)16(15)21/h11-12,21H,4-10H2,1-3H3 |
| InChIKey | RWJOLZFUDYUKAI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|