C14H22Cl2N2O — CID 82978878
2,4-dichloro-6-[[2-(dimethylamino)ethyl-propylamino]methyl]phenol (PubChem CID 82978878) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 2,4-dichloro-6-[[2-(dimethylamino)ethyl-propylamino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[2-(dimethylamino)ethyl-propylamino]methyl]phenol |
|---|---|
| PubChem CID | 82978878 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,4-dichloro-6-[[2-(dimethylamino)ethyl-propylamino]methyl]phenol |
| SMILES | CCCN(CCN(C)C)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H22Cl2N2O/c1-4-5-18(7-6-17(2)3)10-11-8-12(15)9-13(16)14(11)19/h8-9,19H,4-7,10H2,1-3H3 |
| InChIKey | UGNSIUVFNYTWOF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|