C11H12Cl2F3NO — CID 82981653
2,4-dichloro-6-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]phenol (PubChem CID 82981653) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 2,4-dichloro-6-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82981653 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2,4-dichloro-6-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]phenol |
| SMILES | CCN(Cc1cc(Cl)cc(Cl)c1O)CC(F)(F)F |
| InChI | InChI=1S/C11H12Cl2F3NO/c1-2-17(6-11(14,15)16)5-7-3-8(12)4-9(13)10(7)18/h3-4,18H,2,5-6H2,1H3 |
| InChIKey | FZYPOHBSENBSCL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|