C15H23Cl2NO3 — CID 82966178
2-[[bis(2-ethoxyethyl)amino]methyl]-4,6-dichlorophenol (PubChem CID 82966178) has the molecular formula C15H23Cl2NO3 and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-[[bis(2-ethoxyethyl)amino]methyl]-4,6-dichlorophenol.
| Compound Name | 2-[[bis(2-ethoxyethyl)amino]methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 82966178 |
| Molecular Formula | C15H23Cl2NO3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-[[bis(2-ethoxyethyl)amino]methyl]-4,6-dichlorophenol |
| SMILES | CCOCCN(CCOCC)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H23Cl2NO3/c1-3-20-7-5-18(6-8-21-4-2)11-12-9-13(16)10-14(17)15(12)19/h9-10,19H,3-8,11H2,1-2H3 |
| InChIKey | CQMUOKOOCFWZKF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|