C12H17Cl2NO2 — CID 112754699
2,4-dichloro-6-[[2-methoxypropyl(methyl)amino]methyl]phenol (PubChem CID 112754699) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2,4-dichloro-6-[[2-methoxypropyl(methyl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[2-methoxypropyl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 112754699 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2,4-dichloro-6-[[2-methoxypropyl(methyl)amino]methyl]phenol |
| SMILES | COC(C)CN(C)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H17Cl2NO2/c1-8(17-3)6-15(2)7-9-4-10(13)5-11(14)12(9)16/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | JMWIWXNHBPVQGD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|